C10H11BrFNO — CID 115410640
5-bromo-N-ethyl-6-fluoro-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 115410640) has the molecular formula C10H11BrFNO and a molecular weight of 260.11 g/mol. Its IUPAC name is 5-bromo-N-ethyl-6-fluoro-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 5-bromo-N-ethyl-6-fluoro-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 115410640 |
| Molecular Formula | C10H11BrFNO |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 5-bromo-N-ethyl-6-fluoro-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCNC1COc2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C10H11BrFNO/c1-2-13-9-5-14-10-4-8(12)7(11)3-6(9)10/h3-4,9,13H,2,5H2,1H3 |
| InChIKey | BAASYADFEBGYRU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |