C13H19NO — CID 43512441
N-ethyl-5-propan-2-yl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 43512441) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-ethyl-5-propan-2-yl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | N-ethyl-5-propan-2-yl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 43512441 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-ethyl-5-propan-2-yl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCNC1COc2ccc(C(C)C)cc21 |
| InChI | InChI=1S/C13H19NO/c1-4-14-12-8-15-13-6-5-10(9(2)3)7-11(12)13/h5-7,9,12,14H,4,8H2,1-3H3 |
| InChIKey | GLJKBPOWRFJHCV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |