C14H20BrN — CID 115417695
7-bromo-N,4,5,8-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 115417695) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is 7-bromo-N,4,5,8-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 7-bromo-N,4,5,8-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 115417695 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 7-bromo-N,4,5,8-tetramethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CNC1CCC(C)c2c(C)cc(Br)c(C)c21 |
| InChI | InChI=1S/C14H20BrN/c1-8-5-6-12(16-4)14-10(3)11(15)7-9(2)13(8)14/h7-8,12,16H,5-6H2,1-4H3 |
| InChIKey | DPDDJQWIDFHGCX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |