C11H13Br — CID 166534603
5-bromo-1,7-dimethyl-2,3-dihydro-1H-indene (PubChem CID 166534603) has the molecular formula C11H13Br and a molecular weight of 225.13 g/mol. Its IUPAC name is 5-bromo-1,7-dimethyl-2,3-dihydro-1H-indene.
| Compound Name | 5-bromo-1,7-dimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 166534603 |
| Molecular Formula | C11H13Br |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 5-bromo-1,7-dimethyl-2,3-dihydro-1H-indene |
| SMILES | Cc1cc(Br)cc2c1C(C)CC2 |
| InChI | InChI=1S/C11H13Br/c1-7-3-4-9-6-10(12)5-8(2)11(7)9/h5-7H,3-4H2,1-2H3 |
| InChIKey | BAHRCCPEQZWQCF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |