C14H20 — CID 170736432
5-ethyl-1,6,7-trimethyl-2,3-dihydro-1H-indene (PubChem CID 170736432) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 5-ethyl-1,6,7-trimethyl-2,3-dihydro-1H-indene.
| Compound Name | 5-ethyl-1,6,7-trimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 170736432 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 5-ethyl-1,6,7-trimethyl-2,3-dihydro-1H-indene |
| SMILES | CCc1cc2c(c(C)c1C)C(C)CC2 |
| InChI | InChI=1S/C14H20/c1-5-12-8-13-7-6-9(2)14(13)11(4)10(12)3/h8-9H,5-7H2,1-4H3 |
| InChIKey | AUZIKDDRPFWVER-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |