C18H26 — CID 614939
4,8-diethyl-1,5-dimethyl-1,2,3,5,6,7-hexahydro-s-indacene (PubChem CID 614939) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 4,8-diethyl-1,5-dimethyl-1,2,3,5,6,7-hexahydro-s-indacene.
| Compound Name | 4,8-diethyl-1,5-dimethyl-1,2,3,5,6,7-hexahydro-s-indacene |
|---|---|
| PubChem CID | 614939 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4,8-diethyl-1,5-dimethyl-1,2,3,5,6,7-hexahydro-s-indacene |
| SMILES | CCc1c2c(c(CC)c3c1C(C)CC3)C(C)CC2 |
| InChI | InChI=1S/C18H26/c1-5-13-15-9-7-12(4)18(15)14(6-2)16-10-8-11(3)17(13)16/h11-12H,5-10H2,1-4H3 |
| InChIKey | ZDEXZDSWLXREAV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |