C14H20 — CID 171537068
4-ethyl-1,5,7-trimethyl-2,3-dihydro-1H-indene (PubChem CID 171537068) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 4-ethyl-1,5,7-trimethyl-2,3-dihydro-1H-indene.
| Compound Name | 4-ethyl-1,5,7-trimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 171537068 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 4-ethyl-1,5,7-trimethyl-2,3-dihydro-1H-indene |
| SMILES | CCc1c(C)cc(C)c2c1CCC2C |
| InChI | InChI=1S/C14H20/c1-5-12-10(3)8-11(4)14-9(2)6-7-13(12)14/h8-9H,5-7H2,1-4H3 |
| InChIKey | URKGEULSSOHNNC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |