About 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene
1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene (PubChem CID 15721134) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene.
Analyze 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene?
The IUPAC name of 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene (CID 15721134) is 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene.
What is the SMILES notation for 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene?
The canonical SMILES for 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene is C=C(C)c1ccc2c(c1C)C(C)CC2.
What is the InChIKey of 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene?
The InChIKey is FPCBMUQXHRMHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-9(2)13-8-7-12-6-5-10(3)14(12)11(13)4/h7-8,10H,1,5-6H2,2-4H3.
What are the key properties of 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene?
1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene has a molecular weight of 186.30 g/mol, XLogP of 4.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethyl-6-prop-1-en-2-yl-2,3-dihydro-1H-indene is sourced from PubChem (CID 15721134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).