C20H19Br — CID 174417873
(4R)-8-bromo-4,7-dimethyl-1,2,3,4-tetrahydrochrysene (PubChem CID 174417873) has the molecular formula C20H19Br and a molecular weight of 339.28 g/mol. Its IUPAC name is (4R)-8-bromo-4,7-dimethyl-1,2,3,4-tetrahydrochrysene.
| Compound Name | (4R)-8-bromo-4,7-dimethyl-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174417873 |
| Molecular Formula | C20H19Br |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (4R)-8-bromo-4,7-dimethyl-1,2,3,4-tetrahydrochrysene |
| SMILES | Cc1c(Br)ccc2c1ccc1c3c(ccc12)CCC[C@H]3C |
| InChI | InChI=1S/C20H19Br/c1-12-4-3-5-14-6-7-17-16-10-11-19(21)13(2)15(16)8-9-18(17)20(12)14/h6-12H,3-5H2,1-2H3/t12-/m1/s1 |
| InChIKey | OOFXUDUHBJPAEM-GFCCVEGCSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|