C20H19F — CID 174400514
8-fluoro-4,6-dimethyl-1,2,3,4-tetrahydrochrysene (PubChem CID 174400514) has the molecular formula C20H19F and a molecular weight of 278.37 g/mol. Its IUPAC name is 8-fluoro-4,6-dimethyl-1,2,3,4-tetrahydrochrysene.
| Compound Name | 8-fluoro-4,6-dimethyl-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174400514 |
| Molecular Formula | C20H19F |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 8-fluoro-4,6-dimethyl-1,2,3,4-tetrahydrochrysene |
| SMILES | Cc1cc2c3c(ccc2c2ccc(F)cc12)CCCC3C |
| InChI | InChI=1S/C20H19F/c1-12-4-3-5-14-6-8-17-16-9-7-15(21)11-18(16)13(2)10-19(17)20(12)14/h6-12H,3-5H2,1-2H3 |
| InChIKey | BYPCMTXCGYITPI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|