C17H15F — CID 135038311
4-fluoro-8-methyltetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2(7),3,5,8,11-hexaene (PubChem CID 135038311) has the molecular formula C17H15F and a molecular weight of 238.31 g/mol. Its IUPAC name is 4-fluoro-8-methyltetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2(7),3,5,8,11-hexaene.
| Compound Name | 4-fluoro-8-methyltetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2(7),3,5,8,11-hexaene |
|---|---|
| PubChem CID | 135038311 |
| Molecular Formula | C17H15F |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-fluoro-8-methyltetracyclo[8.6.0.02,7.012,16]hexadeca-1(10),2(7),3,5,8,11-hexaene |
| SMILES | Cc1cc2c(c3cc(F)ccc13)C1CCCC1=C2 |
| InChI | InChI=1S/C17H15F/c1-10-7-12-8-11-3-2-4-15(11)17(12)16-9-13(18)5-6-14(10)16/h5-9,15H,2-4H2,1H3 |
| InChIKey | XPTADABHIFFQGY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |