About 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol
5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol (PubChem CID 155906276) has the molecular formula C9H8BrClO
and a molecular weight of 247.52 g/mol. Its IUPAC name is 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 155906276 |
| Molecular Formula | C9H8BrClO |
| Molecular Weight | 247.52 g/mol |
| Exact Mass | 245.94 |
| IUPAC Name | 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2cc(Br)cc(Cl)c21 |
| InChI | InChI=1S/C9H8BrClO/c10-6-3-5-1-2-8(12)9(5)7(11)4-6/h3-4,8,12H,1-2H2 |
| InChIKey | XACMIFORAPHJLQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol (CID 155906276) is 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol is OC1CCc2cc(Br)cc(Cl)c21.
What is the InChIKey of 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol?
The InChIKey is XACMIFORAPHJLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClO/c10-6-3-5-1-2-8(12)9(5)7(11)4-6/h3-4,8,12H,1-2H2.
What are the key properties of 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol?
5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol has a molecular weight of 247.52 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 155906276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).