C18H25N — CID 115418373
N-(cyclohex-3-en-1-ylmethyl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 115418373) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 115418373 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC1CCC(NCC2CC=CCC2)c2ccccc21 |
| InChI | InChI=1S/C18H25N/c1-14-11-12-18(17-10-6-5-9-16(14)17)19-13-15-7-3-2-4-8-15/h2-3,5-6,9-10,14-15,18-19H,4,7-8,11-13H2,1H3 |
| InChIKey | PXGUBNIEEWAEAE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|