C18H26N2 — CID 115419466
4-methyl-5-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 115419466) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-methyl-5-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 4-methyl-5-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 115419466 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4-methyl-5-(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC1CCC(N2CC3CNCC3C2C)c2ccccc21 |
| InChI | InChI=1S/C18H26N2/c1-12-7-8-18(16-6-4-3-5-15(12)16)20-11-14-9-19-10-17(14)13(20)2/h3-6,12-14,17-19H,7-11H2,1-2H3 |
| InChIKey | XAKKHRBLXQUVJG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |