C35H51N7O5 — CID 11541961
benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-4-methyl-1-oxo-1-[3-oxo-5-(2-phenylethyl)-2-propan-2-ylpiperazin-1-yl]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 11541961) has the molecular formula C35H51N7O5 and a molecular weight of 649.84 g/mol. Its IUPAC name is benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-4-methyl-1-oxo-1-[3-oxo-5-(2-phenylethyl)-2-propan-2-ylpiperazin-1-yl]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-4-methyl-1-oxo-1-[3-oxo-5-(2-phenylethyl)-2-propan-2-ylpiperazin-1-yl]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 11541961 |
| Molecular Formula | C35H51N7O5 |
| Molecular Weight | 649.84 g/mol |
| Exact Mass | 649.40 |
| IUPAC Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-4-methyl-1-oxo-1-[3-oxo-5-(2-phenylethyl)-2-propan-2-ylpiperazin-1-yl]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)OCc1ccccc1)C(=O)N1CC(CCc2ccccc2)NC(=O)C1C(C)C |
| InChI | InChI=1S/C35H51N7O5/c1-23(2)20-29(33(45)42-21-27(39-32(44)30(42)24(3)4)18-17-25-12-7-5-8-13-25)40-31(43)28(16-11-19-38-34(36)37)41-35(46)47-22-26-14-9-6-10-15-26/h5-10,12-15,23-24,27-30H,11,16-22H2,1-4H3,(H,39,44)(H,40,43)(H,41,46)(H4,36,37,38)/t27?,28-,29-,30?/m0/s1 |
| InChIKey | ZJHZKJLEZWBIIW-WKWNBGBUSA-N |
| XLogP | 2.85 |
| TPSA | 181.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|