About methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate
methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate (PubChem CID 115422679) has the molecular formula C11H15NO2S3
and a molecular weight of 289.45 g/mol. Its IUPAC name is methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate.
Analyze methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate (CID 115422679) is methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate is CCC1SCCSC1c1nc(C(=O)OC)cs1.
What is the InChIKey of methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate?
The InChIKey is SIZMSNSREKVVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S3/c1-3-8-9(16-5-4-15-8)10-12-7(6-17-10)11(13)14-2/h6,8-9H,3-5H2,1-2H3.
What are the key properties of methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate?
methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate has a molecular weight of 289.45 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-ethyl-1,4-dithian-2-yl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 115422679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).