C15H19N3O3 — CID 115429770
2-ethyl-2-[(1H-indazole-3-carbonylamino)methyl]butanoic acid (PubChem CID 115429770) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-ethyl-2-[(1H-indazole-3-carbonylamino)methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[(1H-indazole-3-carbonylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 115429770 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-ethyl-2-[(1H-indazole-3-carbonylamino)methyl]butanoic acid |
| SMILES | CCC(CC)(CNC(=O)c1n[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H19N3O3/c1-3-15(4-2,14(20)21)9-16-13(19)12-10-7-5-6-8-11(10)17-18-12/h5-8H,3-4,9H2,1-2H3,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | ZQWJWTOZKIDEPK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |