C15H17N3O — CID 18225967
N-(3-ethylpent-1-yn-3-yl)-1H-indazole-3-carboxamide (PubChem CID 18225967) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N-(3-ethylpent-1-yn-3-yl)-1H-indazole-3-carboxamide.
| Compound Name | N-(3-ethylpent-1-yn-3-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 18225967 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-(3-ethylpent-1-yn-3-yl)-1H-indazole-3-carboxamide |
| SMILES | C#CC(CC)(CC)NC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C15H17N3O/c1-4-15(5-2,6-3)16-14(19)13-11-9-7-8-10-12(11)17-18-13/h1,7-10H,5-6H2,2-3H3,(H,16,19)(H,17,18) |
| InChIKey | BFPUABQSRLFLBZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|