C17H23N3O3 — CID 170858371
2-(1H-indazole-3-carbonylamino)-2-methyloctanoic acid (PubChem CID 170858371) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(1H-indazole-3-carbonylamino)-2-methyloctanoic acid.
| Compound Name | 2-(1H-indazole-3-carbonylamino)-2-methyloctanoic acid |
|---|---|
| PubChem CID | 170858371 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-(1H-indazole-3-carbonylamino)-2-methyloctanoic acid |
| SMILES | CCCCCCC(C)(NC(=O)c1n[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H23N3O3/c1-3-4-5-8-11-17(2,16(22)23)18-15(21)14-12-9-6-7-10-13(12)19-20-14/h6-7,9-10H,3-5,8,11H2,1-2H3,(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | GODOCGWJAXLRJU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|