C14H16FIN2O — CID 115437242
8-fluoro-7-iodospiro[2,5-dihydro-1H-1,5-benzodiazepine-3,1'-cyclohexane]-4-one (PubChem CID 115437242) has the molecular formula C14H16FIN2O and a molecular weight of 374.20 g/mol. Its IUPAC name is 8-fluoro-7-iodospiro[2,5-dihydro-1H-1,5-benzodiazepine-3,1'-cyclohexane]-4-one.
| Compound Name | 8-fluoro-7-iodospiro[2,5-dihydro-1H-1,5-benzodiazepine-3,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 115437242 |
| Molecular Formula | C14H16FIN2O |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 8-fluoro-7-iodospiro[2,5-dihydro-1H-1,5-benzodiazepine-3,1'-cyclohexane]-4-one |
| SMILES | O=C1Nc2cc(I)c(F)cc2NCC12CCCCC2 |
| InChI | InChI=1S/C14H16FIN2O/c15-9-6-11-12(7-10(9)16)18-13(19)14(8-17-11)4-2-1-3-5-14/h6-7,17H,1-5,8H2,(H,18,19) |
| InChIKey | DFVRSTOAUPZRMC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|