C11H14FIN2 — CID 115429343
8-fluoro-7-iodo-3,3-dimethyl-1,2,4,5-tetrahydro-1,5-benzodiazepine (PubChem CID 115429343) has the molecular formula C11H14FIN2 and a molecular weight of 320.15 g/mol. Its IUPAC name is 8-fluoro-7-iodo-3,3-dimethyl-1,2,4,5-tetrahydro-1,5-benzodiazepine.
| Compound Name | 8-fluoro-7-iodo-3,3-dimethyl-1,2,4,5-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 115429343 |
| Molecular Formula | C11H14FIN2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 8-fluoro-7-iodo-3,3-dimethyl-1,2,4,5-tetrahydro-1,5-benzodiazepine |
| SMILES | CC1(C)CNc2cc(F)c(I)cc2NC1 |
| InChI | InChI=1S/C11H14FIN2/c1-11(2)5-14-9-3-7(12)8(13)4-10(9)15-6-11/h3-4,14-15H,5-6H2,1-2H3 |
| InChIKey | OSYDGPZXGCPFCI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|