C11H18N2O3 — CID 115440645
4-propyl-9-oxa-2,4-diazaspiro[5.5]undecane-3,5-dione (PubChem CID 115440645) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-propyl-9-oxa-2,4-diazaspiro[5.5]undecane-3,5-dione.
| Compound Name | 4-propyl-9-oxa-2,4-diazaspiro[5.5]undecane-3,5-dione |
|---|---|
| PubChem CID | 115440645 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-propyl-9-oxa-2,4-diazaspiro[5.5]undecane-3,5-dione |
| SMILES | CCCN1C(=O)NCC2(CCOCC2)C1=O |
| InChI | InChI=1S/C11H18N2O3/c1-2-5-13-9(14)11(8-12-10(13)15)3-6-16-7-4-11/h2-8H2,1H3,(H,12,15) |
| InChIKey | VJMNZPIKGVDLEM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |