C15H17F2N3S — CID 11544740
4-(2-aminoethyl)-3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-imidazole-2-thione (PubChem CID 11544740) has the molecular formula C15H17F2N3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-imidazole-2-thione.
| Compound Name | 4-(2-aminoethyl)-3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 11544740 |
| Molecular Formula | C15H17F2N3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-(2-aminoethyl)-3-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-imidazole-2-thione |
| SMILES | NCCc1c[nH]c(=S)n1[C@H]1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C15H17F2N3S/c16-10-5-9-6-11(1-2-13(9)14(17)7-10)20-12(3-4-18)8-19-15(20)21/h5,7-8,11H,1-4,6,18H2,(H,19,21)/t11-/m0/s1 |
| InChIKey | YSSVPAMNOKPAQE-NSHDSACASA-N |
| XLogP | 3.06 |
| TPSA | 46.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|