C11H14N2S — CID 3035112
1,2,3,4-tetrahydronaphthalen-2-ylthiourea (PubChem CID 3035112) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-2-ylthiourea.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-2-ylthiourea |
|---|---|
| PubChem CID | 3035112 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-2-ylthiourea |
| SMILES | NC(=S)NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C11H14N2S/c12-11(14)13-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7H2,(H3,12,13,14) |
| InChIKey | RQTPBLRMULNSNS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|