About 1-phenylethylthiourea
1-phenylethylthiourea (PubChem CID 2725262) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 1-phenylethylthiourea.
Molecular Properties
| Compound Name | 1-phenylethylthiourea |
| PubChem CID | 2725262 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 1-phenylethylthiourea |
| SMILES | CC(NC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C9H12N2S/c1-7(11-9(10)12)8-5-3-2-4-6-8/h2-7H,1H3,(H3,10,11,12) |
| InChIKey | XTFIWYQHNZIYCQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethylthiourea?
The IUPAC name of 1-phenylethylthiourea (CID 2725262) is 1-phenylethylthiourea.
What is the SMILES notation for 1-phenylethylthiourea?
The canonical SMILES for 1-phenylethylthiourea is CC(NC(N)=S)c1ccccc1.
What is the InChIKey of 1-phenylethylthiourea?
The InChIKey is XTFIWYQHNZIYCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-7(11-9(10)12)8-5-3-2-4-6-8/h2-7H,1H3,(H3,10,11,12).
What are the key properties of 1-phenylethylthiourea?
1-phenylethylthiourea has a molecular weight of 180.28 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethylthiourea is sourced from PubChem (CID 2725262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).