About sodium N-benzylcarbamodithioate
sodium N-benzylcarbamodithioate (PubChem CID 23686905) has the molecular formula C8H8NNaS2
and a molecular weight of 205.28 g/mol. Its IUPAC name is sodium N-benzylcarbamodithioate.
Molecular Properties
| Compound Name | sodium N-benzylcarbamodithioate |
| PubChem CID | 23686905 |
| Molecular Formula | C8H8NNaS2 |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | sodium N-benzylcarbamodithioate |
| SMILES | S=C([S-])NCc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H9NS2.Na/c10-8(11)9-6-7-4-2-1-3-5-7;/h1-5H,6H2,(H2,9,10,11);/q;+1/p-1 |
| InChIKey | XVKPYTQNRNMGEQ-UHFFFAOYSA-M |
| XLogP | -1.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium N-benzylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-benzylcarbamodithioate?
The IUPAC name of sodium N-benzylcarbamodithioate (CID 23686905) is sodium N-benzylcarbamodithioate.
What is the SMILES notation for sodium N-benzylcarbamodithioate?
The canonical SMILES for sodium N-benzylcarbamodithioate is S=C([S-])NCc1ccccc1.[Na+].
What is the InChIKey of sodium N-benzylcarbamodithioate?
The InChIKey is XVKPYTQNRNMGEQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NS2.Na/c10-8(11)9-6-7-4-2-1-3-5-7;/h1-5H,6H2,(H2,9,10,11);/q;+1/p-1.
What are the key properties of sodium N-benzylcarbamodithioate?
sodium N-benzylcarbamodithioate has a molecular weight of 205.28 g/mol, XLogP of -1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-benzylcarbamodithioate is sourced from PubChem (CID 23686905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).