About 1,3-dibenzylthiourea
1,3-dibenzylthiourea (PubChem CID 838375) has the molecular formula C15H16N2S
and a molecular weight of 256.37 g/mol. Its IUPAC name is 1,3-dibenzylthiourea.
Molecular Properties
| Compound Name | 1,3-dibenzylthiourea |
| PubChem CID | 838375 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1,3-dibenzylthiourea |
| SMILES | S=C(NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C15H16N2S/c18-15(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,16,17,18) |
| InChIKey | LQZPSWMMTICWHD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibenzylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibenzylthiourea?
The IUPAC name of 1,3-dibenzylthiourea (CID 838375) is 1,3-dibenzylthiourea.
What is the SMILES notation for 1,3-dibenzylthiourea?
The canonical SMILES for 1,3-dibenzylthiourea is S=C(NCc1ccccc1)NCc1ccccc1.
What is the InChIKey of 1,3-dibenzylthiourea?
The InChIKey is LQZPSWMMTICWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2S/c18-15(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,16,17,18).
What are the key properties of 1,3-dibenzylthiourea?
1,3-dibenzylthiourea has a molecular weight of 256.37 g/mol, XLogP of 2.85, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibenzylthiourea is sourced from PubChem (CID 838375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).