About benzylthiourea
benzylthiourea (PubChem CID 737375) has the molecular formula C8H10N2S
and a molecular weight of 166.25 g/mol. Its IUPAC name is benzylthiourea.
Molecular Properties
| Compound Name | benzylthiourea |
| PubChem CID | 737375 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | benzylthiourea |
| SMILES | NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C8H10N2S/c9-8(11)10-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10,11) |
| InChIKey | UCGFRIAOVLXVKL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylthiourea?
The IUPAC name of benzylthiourea (CID 737375) is benzylthiourea.
What is the SMILES notation for benzylthiourea?
The canonical SMILES for benzylthiourea is NC(=S)NCc1ccccc1.
What is the InChIKey of benzylthiourea?
The InChIKey is UCGFRIAOVLXVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S/c9-8(11)10-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,9,10,11).
What are the key properties of benzylthiourea?
benzylthiourea has a molecular weight of 166.25 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzylthiourea is sourced from PubChem (CID 737375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).