C14H18N2S — CID 5237269
1-cyclopropyl-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea (PubChem CID 5237269) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea.
| Compound Name | 1-cyclopropyl-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
|---|---|
| PubChem CID | 5237269 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-cyclopropyl-3-(1,2,3,4-tetrahydronaphthalen-1-yl)thiourea |
| SMILES | S=C(NC1CC1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C14H18N2S/c17-14(15-11-8-9-11)16-13-7-3-5-10-4-1-2-6-12(10)13/h1-2,4,6,11,13H,3,5,7-9H2,(H2,15,16,17) |
| InChIKey | AESGCLUMDXCWSQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|