C15H20ClN3S — CID 11565813
4-(2-aminoethyl)-3-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-imidazole-2-thione;hydrochloride (PubChem CID 11565813) has the molecular formula C15H20ClN3S and a molecular weight of 309.87 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-imidazole-2-thione;hydrochloride.
| Compound Name | 4-(2-aminoethyl)-3-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-imidazole-2-thione;hydrochloride |
|---|---|
| PubChem CID | 11565813 |
| Molecular Formula | C15H20ClN3S |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 4-(2-aminoethyl)-3-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-imidazole-2-thione;hydrochloride |
| SMILES | Cl.NCCc1c[nH]c(=S)n1[C@H]1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H19N3S.ClH/c16-8-7-14-10-17-15(19)18(14)13-6-5-11-3-1-2-4-12(11)9-13;/h1-4,10,13H,5-9,16H2,(H,17,19);1H/t13-;/m0./s1 |
| InChIKey | SJYQDZZUZFMHOF-ZOWNYOTGSA-N |
| XLogP | 3.20 |
| TPSA | 46.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|