About [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine
[1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine (PubChem CID 115451900) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine |
| PubChem CID | 115451900 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine |
| SMILES | NCC1(c2nncn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C12H20N4/c13-8-12(6-7-12)11-15-14-9-16(11)10-4-2-1-3-5-10/h9-10H,1-8,13H2 |
| InChIKey | HKOOSWXQHUDQOX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine?
The IUPAC name of [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine (CID 115451900) is [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine.
What is the SMILES notation for [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine?
The canonical SMILES for [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine is NCC1(c2nncn2C2CCCCC2)CC1.
What is the InChIKey of [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine?
The InChIKey is HKOOSWXQHUDQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4/c13-8-12(6-7-12)11-15-14-9-16(11)10-4-2-1-3-5-10/h9-10H,1-8,13H2.
What are the key properties of [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine?
[1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine has a molecular weight of 220.32 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-cyclohexyl-1,2,4-triazol-3-yl)cyclopropyl]methanamine is sourced from PubChem (CID 115451900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).