About [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine
[1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine (PubChem CID 115447062) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine.
Analyze [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine?
The IUPAC name of [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine (CID 115447062) is [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine.
What is the SMILES notation for [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine?
The canonical SMILES for [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine is CCn1cnnc1C1(CN)CCC1.
What is the InChIKey of [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine?
The InChIKey is MQCCMBFBANFTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-2-13-7-11-12-8(13)9(6-10)4-3-5-9/h7H,2-6,10H2,1H3.
What are the key properties of [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine?
[1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine has a molecular weight of 180.25 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-ethyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine is sourced from PubChem (CID 115447062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).