C11H20N4 — CID 63126328
4-ethyl-4-(4-ethyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 63126328) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-ethyl-4-(4-ethyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | 4-ethyl-4-(4-ethyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 63126328 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-ethyl-4-(4-ethyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | CCn1cnnc1C1(CC)CCNCC1 |
| InChI | InChI=1S/C11H20N4/c1-3-11(5-7-12-8-6-11)10-14-13-9-15(10)4-2/h9,12H,3-8H2,1-2H3 |
| InChIKey | YPVOXCFMHJGNJC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |