C9H16N4O — CID 115293381
4-(4-ethyl-1,2,4-triazol-3-yl)oxan-4-amine (PubChem CID 115293381) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(4-ethyl-1,2,4-triazol-3-yl)oxan-4-amine.
| Compound Name | 4-(4-ethyl-1,2,4-triazol-3-yl)oxan-4-amine |
|---|---|
| PubChem CID | 115293381 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-(4-ethyl-1,2,4-triazol-3-yl)oxan-4-amine |
| SMILES | CCn1cnnc1C1(N)CCOCC1 |
| InChI | InChI=1S/C9H16N4O/c1-2-13-7-11-12-8(13)9(10)3-5-14-6-4-9/h7H,2-6,10H2,1H3 |
| InChIKey | IMGZNGLFCLAGTL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |