C19H28N2O6 — CID 11545379
[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl 3-ethyl-2-hydroxy-2-phenylpentanoate;nitric acid (PubChem CID 11545379) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl 3-ethyl-2-hydroxy-2-phenylpentanoate;nitric acid.
| Compound Name | [(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl 3-ethyl-2-hydroxy-2-phenylpentanoate;nitric acid |
|---|---|
| PubChem CID | 11545379 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl 3-ethyl-2-hydroxy-2-phenylpentanoate;nitric acid |
| SMILES | CCC(CC)C(O)(C(=O)OCC1[C@H]2CNC[C@@H]12)c1ccccc1.O=[N+]([O-])O |
| InChI | InChI=1S/C19H27NO3.HNO3/c1-3-13(4-2)19(22,14-8-6-5-7-9-14)18(21)23-12-17-15-10-20-11-16(15)17;2-1(3)4/h5-9,13,15-17,20,22H,3-4,10-12H2,1-2H3;(H,2,3,4)/t15-,16+,17?,19?; |
| InChIKey | HKDMEZSVEJGCKN-YAIIRYSVSA-N |
| XLogP | 1.97 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|