C17H15ClN2O — CID 115466354
5-chloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)quinolin-8-amine (PubChem CID 115466354) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-chloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)quinolin-8-amine.
| Compound Name | 5-chloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)quinolin-8-amine |
|---|---|
| PubChem CID | 115466354 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-chloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)quinolin-8-amine |
| SMILES | Clc1ccc(NC2CCCc3occc32)c2ncccc12 |
| InChI | InChI=1S/C17H15ClN2O/c18-13-6-7-15(17-11(13)3-2-9-19-17)20-14-4-1-5-16-12(14)8-10-21-16/h2-3,6-10,14,20H,1,4-5H2 |
| InChIKey | ZKCRVRPPJYYKJX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |