C16H24N2O — CID 115466810
4,4-dimethyl-5-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 115466810) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 4,4-dimethyl-5-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 115466810 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4,4-dimethyl-5-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1(C)C2CNCC2CN1C1CCCc2occc21 |
| InChI | InChI=1S/C16H24N2O/c1-16(2)13-9-17-8-11(13)10-18(16)14-4-3-5-15-12(14)6-7-19-15/h6-7,11,13-14,17H,3-5,8-10H2,1-2H3 |
| InChIKey | ZIBNMEWSNIHGTI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |