C26H30N2O4S — CID 11547227
12b-butyl-9,10-dimethoxy-1-(thiophene-2-carbonyl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one (PubChem CID 11547227) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is 12b-butyl-9,10-dimethoxy-1-(thiophene-2-carbonyl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one.
| Compound Name | 12b-butyl-9,10-dimethoxy-1-(thiophene-2-carbonyl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 11547227 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 12b-butyl-9,10-dimethoxy-1-(thiophene-2-carbonyl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one |
| SMILES | CCCCC12c3[nH]c4cc(OC)c(OC)cc4c3CCN1C(=O)CCC2C(=O)c1cccs1 |
| InChI | InChI=1S/C26H30N2O4S/c1-4-5-11-26-18(24(30)22-7-6-13-33-22)8-9-23(29)28(26)12-10-16-17-14-20(31-2)21(32-3)15-19(17)27-25(16)26/h6-7,13-15,18,27H,4-5,8-12H2,1-3H3 |
| InChIKey | SEQXZLBNCRYFIY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |