C25H28N2O2S — CID 122410982
(1R,3S,12bS)-12b-butyl-3-methyl-1-(thiophene-2-carbonyl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one (PubChem CID 122410982) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is (1R,3S,12bS)-12b-butyl-3-methyl-1-(thiophene-2-carbonyl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one.
| Compound Name | (1R,3S,12bS)-12b-butyl-3-methyl-1-(thiophene-2-carbonyl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 122410982 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | (1R,3S,12bS)-12b-butyl-3-methyl-1-(thiophene-2-carbonyl)-1,2,3,6,7,12-hexahydroindolo[2,3-a]quinolizin-4-one |
| SMILES | CCCC[C@]12c3[nH]c4ccccc4c3CCN1C(=O)[C@@H](C)C[C@H]2C(=O)c1cccs1 |
| InChI | InChI=1S/C25H28N2O2S/c1-3-4-12-25-19(22(28)21-10-7-14-30-21)15-16(2)24(29)27(25)13-11-18-17-8-5-6-9-20(17)26-23(18)25/h5-10,14,16,19,26H,3-4,11-13,15H2,1-2H3/t16-,19-,25-/m0/s1 |
| InChIKey | ZNAQIUGDFZBQFU-GIIVHJRKSA-N |
| XLogP | 5.54 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |