C26H38N2O5 — CID 166865074
ethyl 6,7-dimethoxy-15-(4-methoxybutyl)-17-methyl-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene-1-carboxylate (PubChem CID 166865074) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl 6,7-dimethoxy-15-(4-methoxybutyl)-17-methyl-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene-1-carboxylate.
| Compound Name | ethyl 6,7-dimethoxy-15-(4-methoxybutyl)-17-methyl-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 166865074 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | ethyl 6,7-dimethoxy-15-(4-methoxybutyl)-17-methyl-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene-1-carboxylate |
| SMILES | CCOC(=O)C12CC(CCCCOC)CN(CCc3c1[nH]c1cc(OC)c(OC)cc31)C2C |
| InChI | InChI=1S/C26H38N2O5/c1-6-33-25(29)26-15-18(9-7-8-12-30-3)16-28(17(26)2)11-10-19-20-13-22(31-4)23(32-5)14-21(20)27-24(19)26/h13-14,17-18,27H,6-12,15-16H2,1-5H3 |
| InChIKey | YWLSXYBQNAIOKC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|