C33H44N2O5 — CID 146507211
ethyl (15S)-6,7-dimethoxy-17-methyl-15-(2-methyl-4-phenylmethoxybutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene-1-carboxylate (PubChem CID 146507211) has the molecular formula C33H44N2O5 and a molecular weight of 548.72 g/mol. Its IUPAC name is ethyl (15S)-6,7-dimethoxy-17-methyl-15-(2-methyl-4-phenylmethoxybutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene-1-carboxylate.
| Compound Name | ethyl (15S)-6,7-dimethoxy-17-methyl-15-(2-methyl-4-phenylmethoxybutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 146507211 |
| Molecular Formula | C33H44N2O5 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | ethyl (15S)-6,7-dimethoxy-17-methyl-15-(2-methyl-4-phenylmethoxybutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene-1-carboxylate |
| SMILES | CCOC(=O)C12C[C@H](CC(C)CCOCc3ccccc3)CN(CCc3c1[nH]c1cc(OC)c(OC)cc31)C2C |
| InChI | InChI=1S/C33H44N2O5/c1-6-40-32(36)33-19-25(16-22(2)13-15-39-21-24-10-8-7-9-11-24)20-35(23(33)3)14-12-26-27-17-29(37-4)30(38-5)18-28(27)34-31(26)33/h7-11,17-18,22-23,25,34H,6,12-16,19-21H2,1-5H3/t22?,23?,25-,33?/m0/s1 |
| InChIKey | QCSXJRYXCGRHOY-XADJSBQWSA-N |
| XLogP | 5.89 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|