C25H36N2O4 — CID 146507209
ethyl (15S)-15-(4-hydroxy-2-methylbutyl)-7-methoxy-17-methyl-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene-1-carboxylate (PubChem CID 146507209) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is ethyl (15S)-15-(4-hydroxy-2-methylbutyl)-7-methoxy-17-methyl-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene-1-carboxylate.
| Compound Name | ethyl (15S)-15-(4-hydroxy-2-methylbutyl)-7-methoxy-17-methyl-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 146507209 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | ethyl (15S)-15-(4-hydroxy-2-methylbutyl)-7-methoxy-17-methyl-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraene-1-carboxylate |
| SMILES | CCOC(=O)C12C[C@H](CC(C)CCO)CN(CCc3c1[nH]c1ccc(OC)cc31)C2C |
| InChI | InChI=1S/C25H36N2O4/c1-5-31-24(29)25-14-18(12-16(2)9-11-28)15-27(17(25)3)10-8-20-21-13-19(30-4)6-7-22(21)26-23(20)25/h6-7,13,16-18,26,28H,5,8-12,14-15H2,1-4H3/t16?,17?,18-,25?/m0/s1 |
| InChIKey | QUWYNDPGFXMLQT-ZEEORUNRSA-N |
| XLogP | 3.65 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |