C11H18IN3O3 — CID 115475830
3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-5-iodo-2-methylpyrimidin-4-one (PubChem CID 115475830) has the molecular formula C11H18IN3O3 and a molecular weight of 367.19 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-5-iodo-2-methylpyrimidin-4-one.
| Compound Name | 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-5-iodo-2-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 115475830 |
| Molecular Formula | C11H18IN3O3 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]-5-iodo-2-methylpyrimidin-4-one |
| SMILES | COCCNCC(O)Cn1c(C)ncc(I)c1=O |
| InChI | InChI=1S/C11H18IN3O3/c1-8-14-6-10(12)11(17)15(8)7-9(16)5-13-3-4-18-2/h6,9,13,16H,3-5,7H2,1-2H3 |
| InChIKey | VYDCGHBGDYNTDN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|