C10H16ClN3O3 — CID 115475877
5-chloro-1-[2-hydroxy-3-(2-methoxyethylamino)propyl]pyrimidin-2-one (PubChem CID 115475877) has the molecular formula C10H16ClN3O3 and a molecular weight of 261.71 g/mol. Its IUPAC name is 5-chloro-1-[2-hydroxy-3-(2-methoxyethylamino)propyl]pyrimidin-2-one.
| Compound Name | 5-chloro-1-[2-hydroxy-3-(2-methoxyethylamino)propyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 115475877 |
| Molecular Formula | C10H16ClN3O3 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-chloro-1-[2-hydroxy-3-(2-methoxyethylamino)propyl]pyrimidin-2-one |
| SMILES | COCCNCC(O)Cn1cc(Cl)cnc1=O |
| InChI | InChI=1S/C10H16ClN3O3/c1-17-3-2-12-5-9(15)7-14-6-8(11)4-13-10(14)16/h4,6,9,12,15H,2-3,5,7H2,1H3 |
| InChIKey | ULCNRVXRNYYUBM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|