C9H17N3O4 — CID 115475508
3-[2-hydroxy-3-(2-methoxyethylamino)propyl]imidazolidine-2,4-dione (PubChem CID 115475508) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 115475508 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-[2-hydroxy-3-(2-methoxyethylamino)propyl]imidazolidine-2,4-dione |
| SMILES | COCCNCC(O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C9H17N3O4/c1-16-3-2-10-4-7(13)6-12-8(14)5-11-9(12)15/h7,10,13H,2-6H2,1H3,(H,11,15) |
| InChIKey | VRUCISDXJLQADX-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|