C13H16N2O5 — CID 35583808
3-[(2R)-2-hydroxy-3-(3-methoxyphenoxy)propyl]imidazolidine-2,4-dione (PubChem CID 35583808) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[(2R)-2-hydroxy-3-(3-methoxyphenoxy)propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(2R)-2-hydroxy-3-(3-methoxyphenoxy)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 35583808 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[(2R)-2-hydroxy-3-(3-methoxyphenoxy)propyl]imidazolidine-2,4-dione |
| SMILES | COc1cccc(OC[C@H](O)CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C13H16N2O5/c1-19-10-3-2-4-11(5-10)20-8-9(16)7-15-12(17)6-14-13(15)18/h2-5,9,16H,6-8H2,1H3,(H,14,18)/t9-/m1/s1 |
| InChIKey | BLDGTXBACHBVRT-SECBINFHSA-N |
| XLogP | -0.01 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|