C12H17Cl2NO4S — CID 115476512
1-(2,5-dichlorophenyl)sulfonyl-3-(2-methoxyethylamino)propan-2-ol (PubChem CID 115476512) has the molecular formula C12H17Cl2NO4S and a molecular weight of 342.24 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-3-(2-methoxyethylamino)propan-2-ol.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-3-(2-methoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 115476512 |
| Molecular Formula | C12H17Cl2NO4S |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-3-(2-methoxyethylamino)propan-2-ol |
| SMILES | COCCNCC(O)CS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H17Cl2NO4S/c1-19-5-4-15-7-10(16)8-20(17,18)12-6-9(13)2-3-11(12)14/h2-3,6,10,15-16H,4-5,7-8H2,1H3 |
| InChIKey | FJZCJXODTBJWHZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|