C15H11Cl2NOS — CID 115477752
3-(2,6-dichlorophenyl)sulfinyl-2-phenylpropanenitrile (PubChem CID 115477752) has the molecular formula C15H11Cl2NOS and a molecular weight of 324.23 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)sulfinyl-2-phenylpropanenitrile.
| Compound Name | 3-(2,6-dichlorophenyl)sulfinyl-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 115477752 |
| Molecular Formula | C15H11Cl2NOS |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 3-(2,6-dichlorophenyl)sulfinyl-2-phenylpropanenitrile |
| SMILES | N#CC(CS(=O)c1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H11Cl2NOS/c16-13-7-4-8-14(17)15(13)20(19)10-12(9-18)11-5-2-1-3-6-11/h1-8,12H,10H2 |
| InChIKey | ODVMVGSLAPOJHX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |