C17H16ClFO — CID 115481855
(2-chloro-6-fluorophenyl)-(3,4-diethylphenyl)methanone (PubChem CID 115481855) has the molecular formula C17H16ClFO and a molecular weight of 290.76 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-(3,4-diethylphenyl)methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-(3,4-diethylphenyl)methanone |
|---|---|
| PubChem CID | 115481855 |
| Molecular Formula | C17H16ClFO |
| Molecular Weight | 290.76 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-(3,4-diethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)c2c(F)cccc2Cl)cc1CC |
| InChI | InChI=1S/C17H16ClFO/c1-3-11-8-9-13(10-12(11)4-2)17(20)16-14(18)6-5-7-15(16)19/h5-10H,3-4H2,1-2H3 |
| InChIKey | PZQXJUUOOBLEJE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.76 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |