C9H11BrF3N3 — CID 115486549
5-bromo-N-(5,5,5-trifluoropentyl)pyrimidin-2-amine (PubChem CID 115486549) has the molecular formula C9H11BrF3N3 and a molecular weight of 298.11 g/mol. Its IUPAC name is 5-bromo-N-(5,5,5-trifluoropentyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-N-(5,5,5-trifluoropentyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115486549 |
| Molecular Formula | C9H11BrF3N3 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 5-bromo-N-(5,5,5-trifluoropentyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)CCCCNc1ncc(Br)cn1 |
| InChI | InChI=1S/C9H11BrF3N3/c10-7-5-15-8(16-6-7)14-4-2-1-3-9(11,12)13/h5-6H,1-4H2,(H,14,15,16) |
| InChIKey | QXAOYVOGJQDMDT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|